C18H32F3N5O — CID 111914806
N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]cyclohexanecarboxamide (PubChem CID 111914806) has the molecular formula C18H32F3N5O and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111914806 |
| Molecular Formula | C18H32F3N5O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]ethyl]cyclohexanecarboxamide |
| SMILES | CCN/C(=N\CCNC(=O)C1CCCCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H32F3N5O/c1-2-22-17(25-15-8-11-26(12-15)13-18(19,20)21)24-10-9-23-16(27)14-6-4-3-5-7-14/h14-15H,2-13H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | XKIRJMRNZNOCOT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|