C15H28F3N5O2S — CID 111915983
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915983) has the molecular formula C15H28F3N5O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915983 |
| Molecular Formula | C15H28F3N5O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H28F3N5O2S/c1-2-19-14(20-4-6-22-7-9-26(24,25)10-8-22)21-13-3-5-23(11-13)12-15(16,17)18/h13H,2-12H2,1H3,(H2,19,20,21) |
| InChIKey | QWZXGVWBOBEQRM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|