C15H30N4O2S2 — CID 111530391
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530391) has the molecular formula C15H30N4O2S2 and a molecular weight of 362.57 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530391 |
| Molecular Formula | C15H30N4O2S2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C15H30N4O2S2/c1-3-16-15(18-13-4-5-14(12-13)22-2)17-6-7-19-8-10-23(20,21)11-9-19/h13-14H,3-12H2,1-2H3,(H2,16,17,18) |
| InChIKey | GKJWEVJTAKVMAG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|