C17H36IN5O2S — CID 111019470
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111019470) has the molecular formula C17H36IN5O2S and a molecular weight of 501.48 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111019470 |
| Molecular Formula | C17H36IN5O2S |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/CCN2CCS(=O)(=O)CC2)NCC)CC1.I |
| InChI | InChI=1S/C17H35N5O2S.HI/c1-3-8-21-9-5-16(6-10-21)20-17(18-4-2)19-7-11-22-12-14-25(23,24)15-13-22;/h16H,3-15H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | XSFBMBNRPWMQBJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|