C17H37IN4OS — CID 111827184
2-(2-tert-butylsulfinylethyl)-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111827184) has the molecular formula C17H37IN4OS and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-(2-tert-butylsulfinylethyl)-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 2-(2-tert-butylsulfinylethyl)-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111827184 |
| Molecular Formula | C17H37IN4OS |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-(2-tert-butylsulfinylethyl)-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | CCCN1CCC(N/C(=N/CCS(=O)C(C)(C)C)NCC)CC1.I |
| InChI | InChI=1S/C17H36N4OS.HI/c1-6-11-21-12-8-15(9-13-21)20-16(18-7-2)19-10-14-23(22)17(3,4)5;/h15H,6-14H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | HROVNFMSFUXZQU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|