C17H34IN5O4S — CID 111330199
ethyl 4-[[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111330199) has the molecular formula C17H34IN5O4S and a molecular weight of 531.46 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111330199 |
| Molecular Formula | C17H34IN5O4S |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | ethyl 4-[[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C17H33N5O4S.HI/c1-3-18-16(19-7-10-21-11-13-27(24,25)14-12-21)20-15-5-8-22(9-6-15)17(23)26-4-2;/h15H,3-14H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | ZCTWPQVPQLOLPI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|