C18H33N5O5S — CID 111328420
ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328420) has the molecular formula C18H33N5O5S and a molecular weight of 431.56 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328420 |
| Molecular Formula | C18H33N5O5S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | ethyl 4-[[N'-[3-[(1,1-dioxothiolan-3-yl)amino]-3-oxopropyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H33N5O5S/c1-3-19-17(22-14-6-10-23(11-7-14)18(25)28-4-2)20-9-5-16(24)21-15-8-12-29(26,27)13-15/h14-15H,3-13H2,1-2H3,(H,21,24)(H2,19,20,22) |
| InChIKey | QPTKBMMWWMMQJB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 129.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|