C15H28N4O3S — CID 111141509
N-cyclohexyl-2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]acetamide (PubChem CID 111141509) has the molecular formula C15H28N4O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is N-cyclohexyl-2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111141509 |
| Molecular Formula | C15H28N4O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-cyclohexyl-2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H28N4O3S/c1-2-16-15(19-13-8-9-23(21,22)11-13)17-10-14(20)18-12-6-4-3-5-7-12/h12-13H,2-11H2,1H3,(H,18,20)(H2,16,17,19) |
| InChIKey | GFJRAIUHPROKRS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|