C9H19N3O2S — CID 110913622
1-(1,1-dioxothiolan-3-yl)-2,3-diethylguanidine (PubChem CID 110913622) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2,3-diethylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2,3-diethylguanidine |
|---|---|
| PubChem CID | 110913622 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2,3-diethylguanidine |
| SMILES | CC/N=C(\NCC)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19N3O2S/c1-3-10-9(11-4-2)12-8-5-6-15(13,14)7-8/h8H,3-7H2,1-2H3,(H2,10,11,12) |
| InChIKey | YKFHFAMHFAHOBJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|