C12H26N4O2S — CID 111141947
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine (PubChem CID 111141947) has the molecular formula C12H26N4O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111141947 |
| Molecular Formula | C12H26N4O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCN(C)CC)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H26N4O2S/c1-4-13-12(14-7-8-16(3)5-2)15-11-6-9-19(17,18)10-11/h11H,4-10H2,1-3H3,(H2,13,14,15) |
| InChIKey | ZEZHDNMRPOLZGH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|