C13H28N4O4S2 — CID 111140445
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine (PubChem CID 111140445) has the molecular formula C13H28N4O4S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111140445 |
| Molecular Formula | C13H28N4O4S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CCCN(C)S(=O)(=O)CC)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H28N4O4S2/c1-4-14-13(16-12-7-10-22(18,19)11-12)15-8-6-9-17(3)23(20,21)5-2/h12H,4-11H2,1-3H3,(H2,14,15,16) |
| InChIKey | KSLNNGOSHMUNMU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|