C14H30N4O2S — CID 110991769
1-cyclopentyl-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine (PubChem CID 110991769) has the molecular formula C14H30N4O2S and a molecular weight of 318.49 g/mol. Its IUPAC name is 1-cyclopentyl-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine.
| Compound Name | 1-cyclopentyl-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 110991769 |
| Molecular Formula | C14H30N4O2S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-cyclopentyl-3-ethyl-2-[3-[ethylsulfonyl(methyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CCCN(C)S(=O)(=O)CC)NC1CCCC1 |
| InChI | InChI=1S/C14H30N4O2S/c1-4-15-14(17-13-9-6-7-10-13)16-11-8-12-18(3)21(19,20)5-2/h13H,4-12H2,1-3H3,(H2,15,16,17) |
| InChIKey | YHCPVZTUOPPVJQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|