C14H28N4O2S — CID 111140751
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 111140751) has the molecular formula C14H28N4O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111140751 |
| Molecular Formula | C14H28N4O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-(3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCN1CCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H28N4O2S/c1-2-15-14(17-13-6-11-21(19,20)12-13)16-7-5-10-18-8-3-4-9-18/h13H,2-12H2,1H3,(H2,15,16,17) |
| InChIKey | CIZOHZTYZQHHMP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|