C16H32IN3O3S — CID 111141168
2-(3-cyclohexyloxypropyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111141168) has the molecular formula C16H32IN3O3S and a molecular weight of 473.42 g/mol. Its IUPAC name is 2-(3-cyclohexyloxypropyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(3-cyclohexyloxypropyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111141168 |
| Molecular Formula | C16H32IN3O3S |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-(3-cyclohexyloxypropyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC1CCCCC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H31N3O3S.HI/c1-2-17-16(19-14-9-12-23(20,21)13-14)18-10-6-11-22-15-7-4-3-5-8-15;/h14-15H,2-13H2,1H3,(H2,17,18,19);1H |
| InChIKey | RBFAQOXXOFNZBQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|