C12H26IN3O4S — CID 111142358
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111142358) has the molecular formula C12H26IN3O4S and a molecular weight of 435.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111142358 |
| Molecular Formula | C12H26IN3O4S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-methoxyethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCCOC)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C12H25N3O4S.HI/c1-3-13-12(14-5-6-19-8-7-18-2)15-11-4-9-20(16,17)10-11;/h11H,3-10H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | OZXOFRAVXUYZGV-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|