C13H27IN4O3S — CID 111143037
N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111143037) has the molecular formula C13H27IN4O3S and a molecular weight of 446.36 g/mol. Its IUPAC name is N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111143037 |
| Molecular Formula | C13H27IN4O3S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C13H26N4O3S.HI/c1-4-14-13(16-7-6-15-12(18)10(2)3)17-11-5-8-21(19,20)9-11;/h10-11H,4-9H2,1-3H3,(H,15,18)(H2,14,16,17);1H |
| InChIKey | VWNUJDPVKQJJOP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|