C17H35IN4O4S — CID 109391477
tert-butyl N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109391477) has the molecular formula C17H35IN4O4S and a molecular weight of 518.46 g/mol. Its IUPAC name is tert-butyl N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109391477 |
| Molecular Formula | C17H35IN4O4S |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | tert-butyl N-[2-[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CC/N=C(\NCC)NC1CCS(=O)(=O)C1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C17H34N4O4S.HI/c1-6-10-21(16(22)25-17(3,4)5)11-9-19-15(18-7-2)20-14-8-12-26(23,24)13-14;/h14H,6-13H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | DKISGLZXLWUMRI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|