C23H48IN5O3 — CID 109395755
tert-butyl N-[2-[[ethylamino-[[1-(2-propan-2-yloxyethyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109395755) has the molecular formula C23H48IN5O3 and a molecular weight of 569.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[[1-(2-propan-2-yloxyethyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[ethylamino-[[1-(2-propan-2-yloxyethyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109395755 |
| Molecular Formula | C23H48IN5O3 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[[1-(2-propan-2-yloxyethyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CC/N=C(\NCC)NC1CCN(CCOC(C)C)CC1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C23H47N5O3.HI/c1-8-13-28(22(29)31-23(5,6)7)16-12-25-21(24-9-2)26-20-10-14-27(15-11-20)17-18-30-19(3)4;/h19-20H,8-18H2,1-7H3,(H2,24,25,26);1H |
| InChIKey | LDFXDWOZXKHQHT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|