C22H46IN5O3 — CID 109395743
tert-butyl N-[2-[[N'-methyl-N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109395743) has the molecular formula C22H46IN5O3 and a molecular weight of 555.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109395743 |
| Molecular Formula | C22H46IN5O3 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[1-(2-propan-2-yloxyethyl)piperidin-4-yl]carbamimidoyl]amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN(CCN/C(=N\C)NC1CCN(CCOC(C)C)CC1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C22H45N5O3.HI/c1-8-12-27(21(28)30-22(4,5)6)15-11-24-20(23-7)25-19-9-13-26(14-10-19)16-17-29-18(2)3;/h18-19H,8-17H2,1-7H3,(H2,23,24,25);1H |
| InChIKey | YRPISFBJLQGFQM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|