C15H33IN4O2 — CID 109391805
tert-butyl N-[2-[(N'-methyl-N-propylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide (PubChem CID 109391805) has the molecular formula C15H33IN4O2 and a molecular weight of 428.36 g/mol. Its IUPAC name is tert-butyl N-[2-[(N'-methyl-N-propylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[(N'-methyl-N-propylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109391805 |
| Molecular Formula | C15H33IN4O2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | tert-butyl N-[2-[(N'-methyl-N-propylcarbamimidoyl)amino]ethyl]-N-propylcarbamate;hydroiodide |
| SMILES | CCCN/C(=N\C)NCCN(CCC)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C15H32N4O2.HI/c1-7-9-17-13(16-6)18-10-12-19(11-8-2)14(20)21-15(3,4)5;/h7-12H2,1-6H3,(H2,16,17,18);1H |
| InChIKey | WCQNOUONKANTQS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|