C21H36N4O5 — CID 109391490
tert-butyl N-[2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate (PubChem CID 109391490) has the molecular formula C21H36N4O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 109391490 |
| Molecular Formula | C21H36N4O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCN/C(=N\C)Nc1cc(OC)c(OC)c(OC)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36N4O5/c1-9-11-25(20(26)30-21(2,3)4)12-10-23-19(22-5)24-15-13-16(27-6)18(29-8)17(14-15)28-7/h13-14H,9-12H2,1-8H3,(H2,22,23,24) |
| InChIKey | WISFNBNEGZIXTO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|