C16H26N4O5 — CID 111146228
N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]acetamide (PubChem CID 111146228) has the molecular formula C16H26N4O5 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111146228 |
| Molecular Formula | C16H26N4O5 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-(3,4,5-trimethoxyphenyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NCCOC)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26N4O5/c1-17-16(19-10-14(21)18-6-7-22-2)20-11-8-12(23-3)15(25-5)13(9-11)24-4/h8-9H,6-7,10H2,1-5H3,(H,18,21)(H2,17,19,20) |
| InChIKey | CAXWFCUHUZRBLG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|