C17H26N2O6 — CID 43045435
N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 43045435) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 43045435 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-[2-(2-methoxyethylamino)-2-oxoethyl]-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COCCNC(=O)CNC(=O)CCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O6/c1-22-8-7-18-16(21)11-19-15(20)6-5-12-9-13(23-2)17(25-4)14(10-12)24-3/h9-10H,5-8,11H2,1-4H3,(H,18,21)(H,19,20) |
| InChIKey | QTDIOUVMSHHZDS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|