C16H23NO7 — CID 2573383
[2-(2-methoxyethylamino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 2573383) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 2573383 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COCCNC(=O)COC(=O)Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H23NO7/c1-20-6-5-17-14(18)10-24-15(19)9-11-7-12(21-2)16(23-4)13(8-11)22-3/h7-8H,5-6,9-10H2,1-4H3,(H,17,18) |
| InChIKey | KPRCVUQHGSRHHB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|