C17H27NO5 — CID 8008074
N-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 8008074) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8008074 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-(3-propan-2-yloxypropyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)NCCCOC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H27NO5/c1-12(2)23-8-6-7-18-16(19)11-13-9-14(20-3)17(22-5)15(10-13)21-4/h9-10,12H,6-8,11H2,1-5H3,(H,18,19) |
| InChIKey | HZHKBMSANKXMER-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|