C18H29N3O4 — CID 119393671
N-(3-piperazin-1-ylpropyl)-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 119393671) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-(3-piperazin-1-ylpropyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 119393671 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)NCCCN2CCNCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H29N3O4/c1-23-15-11-14(12-16(24-2)18(15)25-3)13-17(22)20-5-4-8-21-9-6-19-7-10-21/h11-12,19H,4-10,13H2,1-3H3,(H,20,22) |
| InChIKey | XEPOBSVRBUGLQN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|