C14H23ClN2O4 — CID 119503323
N-[2-(methylamino)ethyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride (PubChem CID 119503323) has the molecular formula C14H23ClN2O4 and a molecular weight of 318.80 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119503323 |
| Molecular Formula | C14H23ClN2O4 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-(3,4,5-trimethoxyphenyl)acetamide;hydrochloride |
| SMILES | CNCCNC(=O)Cc1cc(OC)c(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C14H22N2O4.ClH/c1-15-5-6-16-13(17)9-10-7-11(18-2)14(20-4)12(8-10)19-3;/h7-8,15H,5-6,9H2,1-4H3,(H,16,17);1H |
| InChIKey | BAPUZLNNQFMXKJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|