C15H20F3NO2 — CID 47015106
N-(3-propan-2-yloxypropyl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 47015106) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-(3-propan-2-yloxypropyl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(3-propan-2-yloxypropyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47015106 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-(3-propan-2-yloxypropyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)OCCCNC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO2/c1-11(2)21-9-3-8-19-14(20)10-12-4-6-13(7-5-12)15(16,17)18/h4-7,11H,3,8-10H2,1-2H3,(H,19,20) |
| InChIKey | ZWJWVGAYXIHUMU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|