C15H18F3NO3 — CID 134008850
ethyl 4-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]butanoate (PubChem CID 134008850) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 134008850 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | ethyl 4-[[2-[4-(trifluoromethyl)phenyl]acetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3NO3/c1-2-22-14(21)4-3-9-19-13(20)10-11-5-7-12(8-6-11)15(16,17)18/h5-8H,2-4,9-10H2,1H3,(H,19,20) |
| InChIKey | WMRUJDXDWYLSKA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|