C19H17F5N2O3 — CID 34508604
N-[2-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 34508604) has the molecular formula C19H17F5N2O3 and a molecular weight of 416.35 g/mol. Its IUPAC name is N-[2-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 34508604 |
| Molecular Formula | C19H17F5N2O3 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[2-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Cc1ccc(OC(F)F)cc1)NCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F5N2O3/c20-18(21)29-15-7-1-12(2-8-15)11-16(27)25-9-10-26-17(28)13-3-5-14(6-4-13)19(22,23)24/h1-8,18H,9-11H2,(H,25,27)(H,26,28) |
| InChIKey | CCKRKWAIRSMQJS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|