C16H12F5NO2 — CID 27147330
N-[4-(difluoromethoxy)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 27147330) has the molecular formula C16H12F5NO2 and a molecular weight of 345.27 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 27147330 |
| Molecular Formula | C16H12F5NO2 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H12F5NO2/c17-15(18)24-13-7-5-12(6-8-13)22-14(23)9-10-1-3-11(4-2-10)16(19,20)21/h1-8,15H,9H2,(H,22,23) |
| InChIKey | RRXNYDXNVUPUOA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |