C16H15F3N2O3S — CID 55548784
N-[4-(sulfamoylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 55548784) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is N-[4-(sulfamoylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-(sulfamoylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55548784 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-[4-(sulfamoylmethyl)phenyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | NS(=O)(=O)Cc1ccc(NC(=O)Cc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3N2O3S/c17-16(18,19)13-5-1-11(2-6-13)9-15(22)21-14-7-3-12(4-8-14)10-25(20,23)24/h1-8H,9-10H2,(H,21,22)(H2,20,23,24) |
| InChIKey | RLYYTOREOCMOIZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |