C16H15F3N2O3S — CID 51130123
1-[4-(methylsulfonylmethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 51130123) has the molecular formula C16H15F3N2O3S and a molecular weight of 372.37 g/mol. Its IUPAC name is 1-[4-(methylsulfonylmethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(methylsulfonylmethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 51130123 |
| Molecular Formula | C16H15F3N2O3S |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[4-(methylsulfonylmethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CS(=O)(=O)Cc1ccc(NC(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3N2O3S/c1-25(23,24)10-11-2-6-13(7-3-11)20-15(22)21-14-8-4-12(5-9-14)16(17,18)19/h2-9H,10H2,1H3,(H2,20,21,22) |
| InChIKey | JIPYYDPSVGUNKB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |