C10H12F3N3O3S — CID 60799942
1-(2-sulfamoylethyl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 60799942) has the molecular formula C10H12F3N3O3S and a molecular weight of 311.29 g/mol. Its IUPAC name is 1-(2-sulfamoylethyl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-sulfamoylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 60799942 |
| Molecular Formula | C10H12F3N3O3S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-(2-sulfamoylethyl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | NS(=O)(=O)CCNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H12F3N3O3S/c11-10(12,13)7-1-3-8(4-2-7)16-9(17)15-5-6-20(14,18)19/h1-4H,5-6H2,(H2,14,18,19)(H2,15,16,17) |
| InChIKey | YSBNSVVXAMXISF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |