C11H17N3O4S — CID 61342170
1-[4-(1-hydroxyethyl)phenyl]-3-(2-sulfamoylethyl)urea (PubChem CID 61342170) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)phenyl]-3-(2-sulfamoylethyl)urea.
| Compound Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(2-sulfamoylethyl)urea |
|---|---|
| PubChem CID | 61342170 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(2-sulfamoylethyl)urea |
| SMILES | CC(O)c1ccc(NC(=O)NCCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H17N3O4S/c1-8(15)9-2-4-10(5-3-9)14-11(16)13-6-7-19(12,17)18/h2-5,8,15H,6-7H2,1H3,(H2,12,17,18)(H2,13,14,16) |
| InChIKey | SQQLEZDMLBDCNW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |