C11H13F3N2O2 — CID 61347612
1-[4-(1-hydroxyethyl)phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 61347612) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 61347612 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(O)c1ccc(NC(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-7(17)8-2-4-9(5-3-8)16-10(18)15-6-11(12,13)14/h2-5,7,17H,6H2,1H3,(H2,15,16,18) |
| InChIKey | QKSNQPHWMDZIEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |