C15H19F3N4O2 — CID 86919769
2-[4-(prop-2-enylcarbamoylamino)anilino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 86919769) has the molecular formula C15H19F3N4O2 and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-[4-(prop-2-enylcarbamoylamino)anilino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[4-(prop-2-enylcarbamoylamino)anilino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 86919769 |
| Molecular Formula | C15H19F3N4O2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[4-(prop-2-enylcarbamoylamino)anilino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(C)C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N4O2/c1-3-8-19-14(24)22-12-6-4-11(5-7-12)21-10(2)13(23)20-9-15(16,17)18/h3-7,10,21H,1,8-9H2,2H3,(H,20,23)(H2,19,22,24) |
| InChIKey | MVDXVPCJEKWRKD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|