C15H19N5O2 — CID 95624373
1-[4-[[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]-3-prop-2-enylurea (PubChem CID 95624373) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[4-[[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]-3-prop-2-enylurea.
| Compound Name | 1-[4-[[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 95624373 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[4-[[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]amino]phenyl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(N[C@H](C)c2nnc(C)o2)cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-4-9-16-15(21)18-13-7-5-12(6-8-13)17-10(2)14-20-19-11(3)22-14/h4-8,10,17H,1,9H2,2-3H3,(H2,16,18,21)/t10-/m1/s1 |
| InChIKey | LBAMOXCNFRFPSE-SNVBAGLBSA-N |
| XLogP | 2.86 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|