C18H20N4O2 — CID 87039150
2-(6-methyl-3-pyridinyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide (PubChem CID 87039150) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(6-methyl-3-pyridinyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-(6-methyl-3-pyridinyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 87039150 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-(6-methyl-3-pyridinyl)-N-[4-(prop-2-enylcarbamoylamino)phenyl]acetamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)Cc2ccc(C)nc2)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-3-10-19-18(24)22-16-8-6-15(7-9-16)21-17(23)11-14-5-4-13(2)20-12-14/h3-9,12H,1,10-11H2,2H3,(H,21,23)(H2,19,22,24) |
| InChIKey | YGALMDCQVAPGQG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|