C18H20N2O3 — CID 129401449
(2R)-2-methyl-3-[4-[[2-(6-methyl-3-pyridinyl)acetyl]amino]phenyl]propanoic acid (PubChem CID 129401449) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R)-2-methyl-3-[4-[[2-(6-methyl-3-pyridinyl)acetyl]amino]phenyl]propanoic acid.
| Compound Name | (2R)-2-methyl-3-[4-[[2-(6-methyl-3-pyridinyl)acetyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 129401449 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2R)-2-methyl-3-[4-[[2-(6-methyl-3-pyridinyl)acetyl]amino]phenyl]propanoic acid |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(C[C@@H](C)C(=O)O)cc2)cn1 |
| InChI | InChI=1S/C18H20N2O3/c1-12(18(22)23)9-14-5-7-16(8-6-14)20-17(21)10-15-4-3-13(2)19-11-15/h3-8,11-12H,9-10H2,1-2H3,(H,20,21)(H,22,23)/t12-/m1/s1 |
| InChIKey | BQHHPVPWNLTDLR-GFCCVEGCSA-N |
| XLogP | 2.83 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |