C18H23N5O2 — CID 39193239
N-[4-(prop-2-enylcarbamoylamino)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 39193239) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[4-(prop-2-enylcarbamoylamino)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[4-(prop-2-enylcarbamoylamino)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 39193239 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N-[4-(prop-2-enylcarbamoylamino)phenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | C=CCNC(=O)Nc1ccc(NC(=O)Cc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C18H23N5O2/c1-5-10-19-18(25)21-15-8-6-14(7-9-15)20-17(24)11-16-12(2)22-23(4)13(16)3/h5-9H,1,10-11H2,2-4H3,(H,20,24)(H2,19,21,25) |
| InChIKey | IDCIXMQMIPTMFO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|