C12H13F3N2O3 — CID 40940064
(2S)-2-(1,3-benzodioxol-5-ylamino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 40940064) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 40940064 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C[C@H](Nc1ccc2c(c1)OCO2)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O3/c1-7(11(18)16-5-12(13,14)15)17-8-2-3-9-10(4-8)20-6-19-9/h2-4,7,17H,5-6H2,1H3,(H,16,18)/t7-/m0/s1 |
| InChIKey | WQRXOBZLXQGCFT-ZETCQYMHSA-N |
| XLogP | 1.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|