C9H8F3IN2O — CID 47252527
1-(4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47252527) has the molecular formula C9H8F3IN2O and a molecular weight of 344.07 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47252527 |
| Molecular Formula | C9H8F3IN2O |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 1-(4-iodophenyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C9H8F3IN2O/c10-9(11,12)5-14-8(16)15-7-3-1-6(13)2-4-7/h1-4H,5H2,(H2,14,15,16) |
| InChIKey | PNNDBOVIHWZLNA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|