C11H13IN2O — CID 47032047
1-(cyclopropylmethyl)-3-(4-iodophenyl)urea (PubChem CID 47032047) has the molecular formula C11H13IN2O and a molecular weight of 316.14 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(4-iodophenyl)urea.
| Compound Name | 1-(cyclopropylmethyl)-3-(4-iodophenyl)urea |
|---|---|
| PubChem CID | 47032047 |
| Molecular Formula | C11H13IN2O |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(4-iodophenyl)urea |
| SMILES | O=C(NCC1CC1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C11H13IN2O/c12-9-3-5-10(6-4-9)14-11(15)13-7-8-1-2-8/h3-6,8H,1-2,7H2,(H2,13,14,15) |
| InChIKey | MUASGWOAZBMLJB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|