C16H23IN2O — CID 40538203
1-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyl]-3-(4-iodophenyl)urea (PubChem CID 40538203) has the molecular formula C16H23IN2O and a molecular weight of 386.28 g/mol. Its IUPAC name is 1-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyl]-3-(4-iodophenyl)urea.
| Compound Name | 1-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyl]-3-(4-iodophenyl)urea |
|---|---|
| PubChem CID | 40538203 |
| Molecular Formula | C16H23IN2O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-[[(1R,3S)-3-ethyl-2,2-dimethylcyclobutyl]methyl]-3-(4-iodophenyl)urea |
| SMILES | CC[C@H]1C[C@@H](CNC(=O)Nc2ccc(I)cc2)C1(C)C |
| InChI | InChI=1S/C16H23IN2O/c1-4-11-9-12(16(11,2)3)10-18-15(20)19-14-7-5-13(17)6-8-14/h5-8,11-12H,4,9-10H2,1-3H3,(H2,18,19,20)/t11-,12-/m0/s1 |
| InChIKey | UIAJZRNLRIXGIP-RYUDHWBXSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|