C22H26I2N4O2 — CID 170908270
1-(2-iodophenyl)-3-[[3-[[(2-iodophenyl)carbamoylamino]methyl]-2,2-dimethylcyclobutyl]methyl]urea (PubChem CID 170908270) has the molecular formula C22H26I2N4O2 and a molecular weight of 632.28 g/mol. Its IUPAC name is 1-(2-iodophenyl)-3-[[3-[[(2-iodophenyl)carbamoylamino]methyl]-2,2-dimethylcyclobutyl]methyl]urea.
| Compound Name | 1-(2-iodophenyl)-3-[[3-[[(2-iodophenyl)carbamoylamino]methyl]-2,2-dimethylcyclobutyl]methyl]urea |
|---|---|
| PubChem CID | 170908270 |
| Molecular Formula | C22H26I2N4O2 |
| Molecular Weight | 632.28 g/mol |
| Exact Mass | 632.01 |
| IUPAC Name | 1-(2-iodophenyl)-3-[[3-[[(2-iodophenyl)carbamoylamino]methyl]-2,2-dimethylcyclobutyl]methyl]urea |
| SMILES | CC1(C)C(CNC(=O)Nc2ccccc2I)CC1CNC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C22H26I2N4O2/c1-22(2)14(12-25-20(29)27-18-9-5-3-7-16(18)23)11-15(22)13-26-21(30)28-19-10-6-4-8-17(19)24/h3-10,14-15H,11-13H2,1-2H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | IPJYISAXPMTWMD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.28 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|