C13H20IN3O — CID 108868960
1-[2-(diethylamino)ethyl]-3-(2-iodophenyl)urea (PubChem CID 108868960) has the molecular formula C13H20IN3O and a molecular weight of 361.23 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-(2-iodophenyl)urea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-(2-iodophenyl)urea |
|---|---|
| PubChem CID | 108868960 |
| Molecular Formula | C13H20IN3O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-(2-iodophenyl)urea |
| SMILES | CCN(CC)CCNC(=O)Nc1ccccc1I |
| InChI | InChI=1S/C13H20IN3O/c1-3-17(4-2)10-9-15-13(18)16-12-8-6-5-7-11(12)14/h5-8H,3-4,9-10H2,1-2H3,(H2,15,16,18) |
| InChIKey | ACBFXGBJTXNEFW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|