C16H17IN2O — CID 47192907
1-(2-iodophenyl)-3-(3-phenylpropyl)urea (PubChem CID 47192907) has the molecular formula C16H17IN2O and a molecular weight of 380.23 g/mol. Its IUPAC name is 1-(2-iodophenyl)-3-(3-phenylpropyl)urea.
| Compound Name | 1-(2-iodophenyl)-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 47192907 |
| Molecular Formula | C16H17IN2O |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 1-(2-iodophenyl)-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1ccccc1I |
| InChI | InChI=1S/C16H17IN2O/c17-14-10-4-5-11-15(14)19-16(20)18-12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11H,6,9,12H2,(H2,18,19,20) |
| InChIKey | KAAMLZRAMJSTEM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|