C17H20N2O2 — CID 108871644
1-(2-hydroxyphenyl)-3-(4-phenylbutyl)urea (PubChem CID 108871644) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-3-(4-phenylbutyl)urea.
| Compound Name | 1-(2-hydroxyphenyl)-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 108871644 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-(2-hydroxyphenyl)-3-(4-phenylbutyl)urea |
| SMILES | O=C(NCCCCc1ccccc1)Nc1ccccc1O |
| InChI | InChI=1S/C17H20N2O2/c20-16-12-5-4-11-15(16)19-17(21)18-13-7-6-10-14-8-2-1-3-9-14/h1-5,8-9,11-12,20H,6-7,10,13H2,(H2,18,19,21) |
| InChIKey | YOYSWJNXXGBWPH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|