C36H51N7O3 — CID 101049094
1-[2-[bis[2-(3-phenylpropylcarbamoylamino)ethyl]amino]ethyl]-3-(3-phenylpropyl)urea (PubChem CID 101049094) has the molecular formula C36H51N7O3 and a molecular weight of 629.85 g/mol. Its IUPAC name is 1-[2-[bis[2-(3-phenylpropylcarbamoylamino)ethyl]amino]ethyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[2-[bis[2-(3-phenylpropylcarbamoylamino)ethyl]amino]ethyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 101049094 |
| Molecular Formula | C36H51N7O3 |
| Molecular Weight | 629.85 g/mol |
| Exact Mass | 629.41 |
| IUPAC Name | 1-[2-[bis[2-(3-phenylpropylcarbamoylamino)ethyl]amino]ethyl]-3-(3-phenylpropyl)urea |
| SMILES | O=C(NCCCc1ccccc1)NCCN(CCNC(=O)NCCCc1ccccc1)CCNC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C36H51N7O3/c44-34(37-22-10-19-31-13-4-1-5-14-31)40-25-28-43(29-26-41-35(45)38-23-11-20-32-15-6-2-7-16-32)30-27-42-36(46)39-24-12-21-33-17-8-3-9-18-33/h1-9,13-18H,10-12,19-30H2,(H2,37,40,44)(H2,38,41,45)(H2,39,42,46) |
| InChIKey | BKOYCSZPDAITPH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|